C11H17NO3S — CID 61063067
N-(4-methyl-2-propoxyphenyl)methanesulfonamide (PubChem CID 61063067) has the molecular formula C11H17NO3S and a molecular weight of 243.33 g/mol. Its IUPAC name is N-(4-methyl-2-propoxyphenyl)methanesulfonamide.
| Compound Name | N-(4-methyl-2-propoxyphenyl)methanesulfonamide |
|---|---|
| PubChem CID | 61063067 |
| Molecular Formula | C11H17NO3S |
| Molecular Weight | 243.33 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | N-(4-methyl-2-propoxyphenyl)methanesulfonamide |
| SMILES | CCCOc1cc(C)ccc1NS(C)(=O)=O |
| InChI | InChI=1S/C11H17NO3S/c1-4-7-15-11-8-9(2)5-6-10(11)12-16(3,13)14/h5-6,8,12H,4,7H2,1-3H3 |
| InChIKey | WTAMOFLZZPPATG-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.33 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |