C17H19F2NO — CID 61064898
1-[3-(difluoromethoxy)phenyl]-N-methyl-2-(4-methylphenyl)ethanamine (PubChem CID 61064898) has the molecular formula C17H19F2NO and a molecular weight of 291.34 g/mol. Its IUPAC name is 1-[3-(difluoromethoxy)phenyl]-N-methyl-2-(4-methylphenyl)ethanamine.
| Compound Name | 1-[3-(difluoromethoxy)phenyl]-N-methyl-2-(4-methylphenyl)ethanamine |
|---|---|
| PubChem CID | 61064898 |
| Molecular Formula | C17H19F2NO |
| Molecular Weight | 291.34 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | 1-[3-(difluoromethoxy)phenyl]-N-methyl-2-(4-methylphenyl)ethanamine |
| SMILES | CNC(Cc1ccc(C)cc1)c1cccc(OC(F)F)c1 |
| InChI | InChI=1S/C17H19F2NO/c1-12-6-8-13(9-7-12)10-16(20-2)14-4-3-5-15(11-14)21-17(18)19/h3-9,11,16-17,20H,10H2,1-2H3 |
| InChIKey | HKOBLOBIEVPSLJ-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.34 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |