C15H17ClN2O2 — CID 61065284
2-(chloromethyl)-3-[1-(oxolan-2-yl)ethyl]quinazolin-4-one (PubChem CID 61065284) has the molecular formula C15H17ClN2O2 and a molecular weight of 292.77 g/mol. Its IUPAC name is 2-(chloromethyl)-3-[1-(oxolan-2-yl)ethyl]quinazolin-4-one.
| Compound Name | 2-(chloromethyl)-3-[1-(oxolan-2-yl)ethyl]quinazolin-4-one |
|---|---|
| PubChem CID | 61065284 |
| Molecular Formula | C15H17ClN2O2 |
| Molecular Weight | 292.77 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | 2-(chloromethyl)-3-[1-(oxolan-2-yl)ethyl]quinazolin-4-one |
| SMILES | CC(C1CCCO1)n1c(CCl)nc2ccccc2c1=O |
| InChI | InChI=1S/C15H17ClN2O2/c1-10(13-7-4-8-20-13)18-14(9-16)17-12-6-3-2-5-11(12)15(18)19/h2-3,5-6,10,13H,4,7-9H2,1H3 |
| InChIKey | KFTOOKVVMFTYTK-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.77 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|