C14H29N3O2S — CID 61065292
3-(4-cyclohexylsulfonylpiperazin-1-yl)-2-methylpropan-1-amine (PubChem CID 61065292) has the molecular formula C14H29N3O2S and a molecular weight of 303.47 g/mol. Its IUPAC name is 3-(4-cyclohexylsulfonylpiperazin-1-yl)-2-methylpropan-1-amine.
| Compound Name | 3-(4-cyclohexylsulfonylpiperazin-1-yl)-2-methylpropan-1-amine |
|---|---|
| PubChem CID | 61065292 |
| Molecular Formula | C14H29N3O2S |
| Molecular Weight | 303.47 g/mol |
| Exact Mass | 303.20 |
| IUPAC Name | 3-(4-cyclohexylsulfonylpiperazin-1-yl)-2-methylpropan-1-amine |
| SMILES | CC(CN)CN1CCN(S(=O)(=O)C2CCCCC2)CC1 |
| InChI | InChI=1S/C14H29N3O2S/c1-13(11-15)12-16-7-9-17(10-8-16)20(18,19)14-5-3-2-4-6-14/h13-14H,2-12,15H2,1H3 |
| InChIKey | MHPQBTACELWYBM-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.47 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |