C13H15N3S — CID 61069569
4-(2-phenylimidazol-1-yl)butanethioamide (PubChem CID 61069569) has the molecular formula C13H15N3S and a molecular weight of 245.35 g/mol. Its IUPAC name is 4-(2-phenylimidazol-1-yl)butanethioamide.
| Compound Name | 4-(2-phenylimidazol-1-yl)butanethioamide |
|---|---|
| PubChem CID | 61069569 |
| Molecular Formula | C13H15N3S |
| Molecular Weight | 245.35 g/mol |
| Exact Mass | 245.10 |
| IUPAC Name | 4-(2-phenylimidazol-1-yl)butanethioamide |
| SMILES | NC(=S)CCCn1ccnc1-c1ccccc1 |
| InChI | InChI=1S/C13H15N3S/c14-12(17)7-4-9-16-10-8-15-13(16)11-5-2-1-3-6-11/h1-3,5-6,8,10H,4,7,9H2,(H2,14,17) |
| InChIKey | JCXJYJHCMCRMFB-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.35 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|