C7H14O4S — CID 61069579
2-[2-(2-hydroxyethoxy)ethylsulfanyl]propanoic acid (PubChem CID 61069579) has the molecular formula C7H14O4S and a molecular weight of 194.25 g/mol. Its IUPAC name is 2-[2-(2-hydroxyethoxy)ethylsulfanyl]propanoic acid.
| Compound Name | 2-[2-(2-hydroxyethoxy)ethylsulfanyl]propanoic acid |
|---|---|
| PubChem CID | 61069579 |
| Molecular Formula | C7H14O4S |
| Molecular Weight | 194.25 g/mol |
| Exact Mass | 194.06 |
| IUPAC Name | 2-[2-(2-hydroxyethoxy)ethylsulfanyl]propanoic acid |
| SMILES | CC(SCCOCCO)C(=O)O |
| InChI | InChI=1S/C7H14O4S/c1-6(7(9)10)12-5-4-11-3-2-8/h6,8H,2-5H2,1H3,(H,9,10) |
| InChIKey | YRTOILQYFORPQX-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.25 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|