C6H8N4O — CID 61069642
N-prop-2-enyl-2H-triazole-4-carboxamide (PubChem CID 61069642) has the molecular formula C6H8N4O and a molecular weight of 152.16 g/mol. Its IUPAC name is N-prop-2-enyl-2H-triazole-4-carboxamide.
| Compound Name | N-prop-2-enyl-2H-triazole-4-carboxamide |
|---|---|
| PubChem CID | 61069642 |
| Molecular Formula | C6H8N4O |
| Molecular Weight | 152.16 g/mol |
| Exact Mass | 152.07 |
| IUPAC Name | N-prop-2-enyl-2H-triazole-4-carboxamide |
| SMILES | C=CCNC(=O)c1cn[nH]n1 |
| InChI | InChI=1S/C6H8N4O/c1-2-3-7-6(11)5-4-8-10-9-5/h2,4H,1,3H2,(H,7,11)(H,8,9,10) |
| InChIKey | NFKGHHDSLZAREJ-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.16 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|