About 3,4,5-trichloro-2,6-dimethylpyridine
3,4,5-trichloro-2,6-dimethylpyridine (PubChem CID 610701) has the molecular formula C7H6Cl3N
and a molecular weight of 210.49 g/mol. Its IUPAC name is 3,4,5-trichloro-2,6-dimethylpyridine.
Molecular Properties
| Compound Name | 3,4,5-trichloro-2,6-dimethylpyridine |
| PubChem CID | 610701 |
| Molecular Formula | C7H6Cl3N |
| Molecular Weight | 210.49 g/mol |
| Exact Mass | 208.96 |
| IUPAC Name | 3,4,5-trichloro-2,6-dimethylpyridine |
| SMILES | Cc1nc(C)c(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C7H6Cl3N/c1-3-5(8)7(10)6(9)4(2)11-3/h1-2H3 |
| InChIKey | OHVYZELVCDIERE-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.49 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3,4,5-trichloro-2,6-dimethylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4,5-trichloro-2,6-dimethylpyridine?
The IUPAC name of 3,4,5-trichloro-2,6-dimethylpyridine (CID 610701) is 3,4,5-trichloro-2,6-dimethylpyridine.
What is the SMILES notation for 3,4,5-trichloro-2,6-dimethylpyridine?
The canonical SMILES for 3,4,5-trichloro-2,6-dimethylpyridine is Cc1nc(C)c(Cl)c(Cl)c1Cl.
What is the InChIKey of 3,4,5-trichloro-2,6-dimethylpyridine?
The InChIKey is OHVYZELVCDIERE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6Cl3N/c1-3-5(8)7(10)6(9)4(2)11-3/h1-2H3.
What are the key properties of 3,4,5-trichloro-2,6-dimethylpyridine?
3,4,5-trichloro-2,6-dimethylpyridine has a molecular weight of 210.49 g/mol, XLogP of 3.66, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4,5-trichloro-2,6-dimethylpyridine is sourced from PubChem (CID 610701), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).