C16H16N2O2S — CID 61071724
4-[2-amino-2-(5-methyl-1,3-benzothiazol-2-yl)ethyl]benzene-1,2-diol (PubChem CID 61071724) has the molecular formula C16H16N2O2S and a molecular weight of 300.38 g/mol. Its IUPAC name is 4-[2-amino-2-(5-methyl-1,3-benzothiazol-2-yl)ethyl]benzene-1,2-diol.
| Compound Name | 4-[2-amino-2-(5-methyl-1,3-benzothiazol-2-yl)ethyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 61071724 |
| Molecular Formula | C16H16N2O2S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | 4-[2-amino-2-(5-methyl-1,3-benzothiazol-2-yl)ethyl]benzene-1,2-diol |
| SMILES | Cc1ccc2sc(C(N)Cc3ccc(O)c(O)c3)nc2c1 |
| InChI | InChI=1S/C16H16N2O2S/c1-9-2-5-15-12(6-9)18-16(21-15)11(17)7-10-3-4-13(19)14(20)8-10/h2-6,8,11,19-20H,7,17H2,1H3 |
| InChIKey | LYSFMVVYOIBNGF-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|