C9H10F3NO5S2 — CID 61072977
4-[2-(2,2,2-trifluoroethoxy)ethylsulfamoyl]thiophene-2-carboxylic acid (PubChem CID 61072977) has the molecular formula C9H10F3NO5S2 and a molecular weight of 333.31 g/mol. Its IUPAC name is 4-[2-(2,2,2-trifluoroethoxy)ethylsulfamoyl]thiophene-2-carboxylic acid.
| Compound Name | 4-[2-(2,2,2-trifluoroethoxy)ethylsulfamoyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 61072977 |
| Molecular Formula | C9H10F3NO5S2 |
| Molecular Weight | 333.31 g/mol |
| Exact Mass | 333.00 |
| IUPAC Name | 4-[2-(2,2,2-trifluoroethoxy)ethylsulfamoyl]thiophene-2-carboxylic acid |
| SMILES | O=C(O)c1cc(S(=O)(=O)NCCOCC(F)(F)F)cs1 |
| InChI | InChI=1S/C9H10F3NO5S2/c10-9(11,12)5-18-2-1-13-20(16,17)6-3-7(8(14)15)19-4-6/h3-4,13H,1-2,5H2,(H,14,15) |
| InChIKey | VAIYZFNHOZMHKD-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.31 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|