About 2-[ethyl(sulfamoyl)amino]-1,1,1-trifluoroethane
2-[ethyl(sulfamoyl)amino]-1,1,1-trifluoroethane (PubChem CID 61073941) has the molecular formula C4H9F3N2O2S
and a molecular weight of 206.19 g/mol. Its IUPAC name is 2-[ethyl(sulfamoyl)amino]-1,1,1-trifluoroethane.
Molecular Properties
| Compound Name | 2-[ethyl(sulfamoyl)amino]-1,1,1-trifluoroethane |
| PubChem CID | 61073941 |
| Molecular Formula | C4H9F3N2O2S |
| Molecular Weight | 206.19 g/mol |
| Exact Mass | 206.03 |
| IUPAC Name | 2-[ethyl(sulfamoyl)amino]-1,1,1-trifluoroethane |
| SMILES | CCN(CC(F)(F)F)S(N)(=O)=O |
| InChI | InChI=1S/C4H9F3N2O2S/c1-2-9(12(8,10)11)3-4(5,6)7/h2-3H2,1H3,(H2,8,10,11) |
| InChIKey | JALGOHJMEVQJQJ-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.19 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[ethyl(sulfamoyl)amino]-1,1,1-trifluoroethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[ethyl(sulfamoyl)amino]-1,1,1-trifluoroethane?
The IUPAC name of 2-[ethyl(sulfamoyl)amino]-1,1,1-trifluoroethane (CID 61073941) is 2-[ethyl(sulfamoyl)amino]-1,1,1-trifluoroethane.
What is the SMILES notation for 2-[ethyl(sulfamoyl)amino]-1,1,1-trifluoroethane?
The canonical SMILES for 2-[ethyl(sulfamoyl)amino]-1,1,1-trifluoroethane is CCN(CC(F)(F)F)S(N)(=O)=O.
What is the InChIKey of 2-[ethyl(sulfamoyl)amino]-1,1,1-trifluoroethane?
The InChIKey is JALGOHJMEVQJQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9F3N2O2S/c1-2-9(12(8,10)11)3-4(5,6)7/h2-3H2,1H3,(H2,8,10,11).
What are the key properties of 2-[ethyl(sulfamoyl)amino]-1,1,1-trifluoroethane?
2-[ethyl(sulfamoyl)amino]-1,1,1-trifluoroethane has a molecular weight of 206.19 g/mol, XLogP of 0.07, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[ethyl(sulfamoyl)amino]-1,1,1-trifluoroethane is sourced from PubChem (CID 61073941), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).