C6H14N2O4S — CID 61074091
methyl 2-[propan-2-yl(sulfamoyl)amino]acetate (PubChem CID 61074091) has the molecular formula C6H14N2O4S and a molecular weight of 210.25 g/mol. Its IUPAC name is methyl 2-[propan-2-yl(sulfamoyl)amino]acetate.
| Compound Name | methyl 2-[propan-2-yl(sulfamoyl)amino]acetate |
|---|---|
| PubChem CID | 61074091 |
| Molecular Formula | C6H14N2O4S |
| Molecular Weight | 210.25 g/mol |
| Exact Mass | 210.07 |
| IUPAC Name | methyl 2-[propan-2-yl(sulfamoyl)amino]acetate |
| SMILES | COC(=O)CN(C(C)C)S(N)(=O)=O |
| InChI | InChI=1S/C6H14N2O4S/c1-5(2)8(13(7,10)11)4-6(9)12-3/h5H,4H2,1-3H3,(H2,7,10,11) |
| InChIKey | HLNQMZPAAKQQGK-UHFFFAOYSA-N |
| XLogP | -0.93 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.25 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |