C15H10ClF3N2 — CID 61075587
2-(2-chloroethyl)-1-(2,3-difluorophenyl)-4-fluorobenzimidazole (PubChem CID 61075587) has the molecular formula C15H10ClF3N2 and a molecular weight of 310.71 g/mol. Its IUPAC name is 2-(2-chloroethyl)-1-(2,3-difluorophenyl)-4-fluorobenzimidazole.
| Compound Name | 2-(2-chloroethyl)-1-(2,3-difluorophenyl)-4-fluorobenzimidazole |
|---|---|
| PubChem CID | 61075587 |
| Molecular Formula | C15H10ClF3N2 |
| Molecular Weight | 310.71 g/mol |
| Exact Mass | 310.05 |
| IUPAC Name | 2-(2-chloroethyl)-1-(2,3-difluorophenyl)-4-fluorobenzimidazole |
| SMILES | Fc1cccc(-n2c(CCCl)nc3c(F)cccc32)c1F |
| InChI | InChI=1S/C15H10ClF3N2/c16-8-7-13-20-15-10(18)4-2-6-12(15)21(13)11-5-1-3-9(17)14(11)19/h1-6H,7-8H2 |
| InChIKey | CKQUECFLVYOWOX-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.71 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|