C13H17NO2S — CID 61075799
N,N-diethyl-5-(4-hydroxybut-1-ynyl)thiophene-2-carboxamide (PubChem CID 61075799) has the molecular formula C13H17NO2S and a molecular weight of 251.35 g/mol. Its IUPAC name is N,N-diethyl-5-(4-hydroxybut-1-ynyl)thiophene-2-carboxamide.
| Compound Name | N,N-diethyl-5-(4-hydroxybut-1-ynyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 61075799 |
| Molecular Formula | C13H17NO2S |
| Molecular Weight | 251.35 g/mol |
| Exact Mass | 251.10 |
| IUPAC Name | N,N-diethyl-5-(4-hydroxybut-1-ynyl)thiophene-2-carboxamide |
| SMILES | CCN(CC)C(=O)c1ccc(C#CCCO)s1 |
| InChI | InChI=1S/C13H17NO2S/c1-3-14(4-2)13(16)12-9-8-11(17-12)7-5-6-10-15/h8-9,15H,3-4,6,10H2,1-2H3 |
| InChIKey | ANIMZRGHPFCAQK-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.35 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|