C14H16N2O3S — CID 61076001
N-[2-(cyclopropylamino)-2-oxoethyl]-5-(4-hydroxybut-1-ynyl)thiophene-2-carboxamide (PubChem CID 61076001) has the molecular formula C14H16N2O3S and a molecular weight of 292.36 g/mol. Its IUPAC name is N-[2-(cyclopropylamino)-2-oxoethyl]-5-(4-hydroxybut-1-ynyl)thiophene-2-carboxamide.
| Compound Name | N-[2-(cyclopropylamino)-2-oxoethyl]-5-(4-hydroxybut-1-ynyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 61076001 |
| Molecular Formula | C14H16N2O3S |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | N-[2-(cyclopropylamino)-2-oxoethyl]-5-(4-hydroxybut-1-ynyl)thiophene-2-carboxamide |
| SMILES | O=C(CNC(=O)c1ccc(C#CCCO)s1)NC1CC1 |
| InChI | InChI=1S/C14H16N2O3S/c17-8-2-1-3-11-6-7-12(20-11)14(19)15-9-13(18)16-10-4-5-10/h6-7,10,17H,2,4-5,8-9H2,(H,15,19)(H,16,18) |
| InChIKey | CCGGRGMQKZHWPJ-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|