C14H12F3NO — CID 61076629
2-(2,3-difluoroanilino)-1-(4-fluorophenyl)ethanol (PubChem CID 61076629) has the molecular formula C14H12F3NO and a molecular weight of 267.25 g/mol. Its IUPAC name is 2-(2,3-difluoroanilino)-1-(4-fluorophenyl)ethanol.
| Compound Name | 2-(2,3-difluoroanilino)-1-(4-fluorophenyl)ethanol |
|---|---|
| PubChem CID | 61076629 |
| Molecular Formula | C14H12F3NO |
| Molecular Weight | 267.25 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | 2-(2,3-difluoroanilino)-1-(4-fluorophenyl)ethanol |
| SMILES | OC(CNc1cccc(F)c1F)c1ccc(F)cc1 |
| InChI | InChI=1S/C14H12F3NO/c15-10-6-4-9(5-7-10)13(19)8-18-12-3-1-2-11(16)14(12)17/h1-7,13,18-19H,8H2 |
| InChIKey | OCDKKJYVYNSHAV-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.25 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |