C11H14F2N2 — CID 61076640
[1-(2,3-difluorophenyl)pyrrolidin-3-yl]methanamine (PubChem CID 61076640) has the molecular formula C11H14F2N2 and a molecular weight of 212.24 g/mol. Its IUPAC name is [1-(2,3-difluorophenyl)pyrrolidin-3-yl]methanamine.
| Compound Name | [1-(2,3-difluorophenyl)pyrrolidin-3-yl]methanamine |
|---|---|
| PubChem CID | 61076640 |
| Molecular Formula | C11H14F2N2 |
| Molecular Weight | 212.24 g/mol |
| Exact Mass | 212.11 |
| IUPAC Name | [1-(2,3-difluorophenyl)pyrrolidin-3-yl]methanamine |
| SMILES | NCC1CCN(c2cccc(F)c2F)C1 |
| InChI | InChI=1S/C11H14F2N2/c12-9-2-1-3-10(11(9)13)15-5-4-8(6-14)7-15/h1-3,8H,4-7,14H2 |
| InChIKey | TXIYTVOFFRDAKF-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.24 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |