C16H22O2 — CID 61077701
1-cyclohexyl-3-(3-methoxyphenyl)propan-2-one (PubChem CID 61077701) has the molecular formula C16H22O2 and a molecular weight of 246.35 g/mol. Its IUPAC name is 1-cyclohexyl-3-(3-methoxyphenyl)propan-2-one.
| Compound Name | 1-cyclohexyl-3-(3-methoxyphenyl)propan-2-one |
|---|---|
| PubChem CID | 61077701 |
| Molecular Formula | C16H22O2 |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.16 |
| IUPAC Name | 1-cyclohexyl-3-(3-methoxyphenyl)propan-2-one |
| SMILES | COc1cccc(CC(=O)CC2CCCCC2)c1 |
| InChI | InChI=1S/C16H22O2/c1-18-16-9-5-8-14(12-16)11-15(17)10-13-6-3-2-4-7-13/h5,8-9,12-13H,2-4,6-7,10-11H2,1H3 |
| InChIKey | DDGQVWHNLSHQIO-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |