About 4-nitrobenzoic acid
4-nitrobenzoic acid (PubChem CID 6108) has the molecular formula C7H5NO4
and a molecular weight of 167.12 g/mol. Its IUPAC name is 4-nitrobenzoic acid.
Molecular Properties
| Compound Name | 4-nitrobenzoic acid |
| PubChem CID | 6108 |
| Molecular Formula | C7H5NO4 |
| Molecular Weight | 167.12 g/mol |
| Exact Mass | 167.02 |
| IUPAC Name | 4-nitrobenzoic acid |
| SMILES | O=C(O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C7H5NO4/c9-7(10)5-1-3-6(4-2-5)8(11)12/h1-4H,(H,9,10) |
| InChIKey | OTLNPYWUJOZPPA-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 80.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.12 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-nitrobenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-nitrobenzoic acid?
The IUPAC name of 4-nitrobenzoic acid (CID 6108) is 4-nitrobenzoic acid.
What is the SMILES notation for 4-nitrobenzoic acid?
The canonical SMILES for 4-nitrobenzoic acid is O=C(O)c1ccc([N+](=O)[O-])cc1.
What is the InChIKey of 4-nitrobenzoic acid?
The InChIKey is OTLNPYWUJOZPPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5NO4/c9-7(10)5-1-3-6(4-2-5)8(11)12/h1-4H,(H,9,10).
What are the key properties of 4-nitrobenzoic acid?
4-nitrobenzoic acid has a molecular weight of 167.12 g/mol, XLogP of 1.29, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-nitrobenzoic acid is sourced from PubChem (CID 6108), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).