C7H7F5N2O — CID 61082031
3,3,4,4,4-pentafluoro-1-(1H-imidazol-2-yl)butan-2-ol (PubChem CID 61082031) has the molecular formula C7H7F5N2O and a molecular weight of 230.14 g/mol. Its IUPAC name is 3,3,4,4,4-pentafluoro-1-(1H-imidazol-2-yl)butan-2-ol.
| Compound Name | 3,3,4,4,4-pentafluoro-1-(1H-imidazol-2-yl)butan-2-ol |
|---|---|
| PubChem CID | 61082031 |
| Molecular Formula | C7H7F5N2O |
| Molecular Weight | 230.14 g/mol |
| Exact Mass | 230.05 |
| IUPAC Name | 3,3,4,4,4-pentafluoro-1-(1H-imidazol-2-yl)butan-2-ol |
| SMILES | OC(Cc1ncc[nH]1)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C7H7F5N2O/c8-6(9,7(10,11)12)4(15)3-5-13-1-2-14-5/h1-2,4,15H,3H2,(H,13,14) |
| InChIKey | YCYXYJLZNQPUIU-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.14 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|