About 2-[chloro-(2,4,6-trimethoxyphenyl)methyl]-3-methylthiophene
2-[chloro-(2,4,6-trimethoxyphenyl)methyl]-3-methylthiophene (PubChem CID 61084330) has the molecular formula C15H17ClO3S
and a molecular weight of 312.82 g/mol. Its IUPAC name is 2-[chloro-(2,4,6-trimethoxyphenyl)methyl]-3-methylthiophene.
Molecular Properties
| Compound Name | 2-[chloro-(2,4,6-trimethoxyphenyl)methyl]-3-methylthiophene |
| PubChem CID | 61084330 |
| Molecular Formula | C15H17ClO3S |
| Molecular Weight | 312.82 g/mol |
| Exact Mass | 312.06 |
| IUPAC Name | 2-[chloro-(2,4,6-trimethoxyphenyl)methyl]-3-methylthiophene |
| SMILES | COc1cc(OC)c(C(Cl)c2sccc2C)c(OC)c1 |
| InChI | InChI=1S/C15H17ClO3S/c1-9-5-6-20-15(9)14(16)13-11(18-3)7-10(17-2)8-12(13)19-4/h5-8,14H,1-4H3 |
| InChIKey | JCOGRELVRTVFMM-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.82 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-[chloro-(2,4,6-trimethoxyphenyl)methyl]-3-methylthiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[chloro-(2,4,6-trimethoxyphenyl)methyl]-3-methylthiophene?
The IUPAC name of 2-[chloro-(2,4,6-trimethoxyphenyl)methyl]-3-methylthiophene (CID 61084330) is 2-[chloro-(2,4,6-trimethoxyphenyl)methyl]-3-methylthiophene.
What is the SMILES notation for 2-[chloro-(2,4,6-trimethoxyphenyl)methyl]-3-methylthiophene?
The canonical SMILES for 2-[chloro-(2,4,6-trimethoxyphenyl)methyl]-3-methylthiophene is COc1cc(OC)c(C(Cl)c2sccc2C)c(OC)c1.
What is the InChIKey of 2-[chloro-(2,4,6-trimethoxyphenyl)methyl]-3-methylthiophene?
The InChIKey is JCOGRELVRTVFMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17ClO3S/c1-9-5-6-20-15(9)14(16)13-11(18-3)7-10(17-2)8-12(13)19-4/h5-8,14H,1-4H3.
What are the key properties of 2-[chloro-(2,4,6-trimethoxyphenyl)methyl]-3-methylthiophene?
2-[chloro-(2,4,6-trimethoxyphenyl)methyl]-3-methylthiophene has a molecular weight of 312.82 g/mol, XLogP of 4.41, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[chloro-(2,4,6-trimethoxyphenyl)methyl]-3-methylthiophene is sourced from PubChem (CID 61084330), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).