C14H9ClF4O — CID 61084726
2-[chloro-[3-(difluoromethoxy)phenyl]methyl]-1,4-difluorobenzene (PubChem CID 61084726) has the molecular formula C14H9ClF4O and a molecular weight of 304.67 g/mol. Its IUPAC name is 2-[chloro-[3-(difluoromethoxy)phenyl]methyl]-1,4-difluorobenzene.
| Compound Name | 2-[chloro-[3-(difluoromethoxy)phenyl]methyl]-1,4-difluorobenzene |
|---|---|
| PubChem CID | 61084726 |
| Molecular Formula | C14H9ClF4O |
| Molecular Weight | 304.67 g/mol |
| Exact Mass | 304.03 |
| IUPAC Name | 2-[chloro-[3-(difluoromethoxy)phenyl]methyl]-1,4-difluorobenzene |
| SMILES | Fc1ccc(F)c(C(Cl)c2cccc(OC(F)F)c2)c1 |
| InChI | InChI=1S/C14H9ClF4O/c15-13(11-7-9(16)4-5-12(11)17)8-2-1-3-10(6-8)20-14(18)19/h1-7,13-14H |
| InChIKey | VVIIXSQMXQRDJD-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.67 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|