C13H12BrClO2S — CID 61085407
2-[(2-bromo-4,5-dimethoxyphenyl)-chloromethyl]thiophene (PubChem CID 61085407) has the molecular formula C13H12BrClO2S and a molecular weight of 347.66 g/mol. Its IUPAC name is 2-[(2-bromo-4,5-dimethoxyphenyl)-chloromethyl]thiophene.
| Compound Name | 2-[(2-bromo-4,5-dimethoxyphenyl)-chloromethyl]thiophene |
|---|---|
| PubChem CID | 61085407 |
| Molecular Formula | C13H12BrClO2S |
| Molecular Weight | 347.66 g/mol |
| Exact Mass | 345.94 |
| IUPAC Name | 2-[(2-bromo-4,5-dimethoxyphenyl)-chloromethyl]thiophene |
| SMILES | COc1cc(Br)c(C(Cl)c2cccs2)cc1OC |
| InChI | InChI=1S/C13H12BrClO2S/c1-16-10-6-8(9(14)7-11(10)17-2)13(15)12-4-3-5-18-12/h3-7,13H,1-2H3 |
| InChIKey | YHDGEOZDNZQEDN-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.66 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|