C12H9ClF5NO — CID 61085820
5-(1-chloro-2,2,3,3,3-pentafluoropropyl)-1-methyl-3H-indol-2-one (PubChem CID 61085820) has the molecular formula C12H9ClF5NO and a molecular weight of 313.65 g/mol. Its IUPAC name is 5-(1-chloro-2,2,3,3,3-pentafluoropropyl)-1-methyl-3H-indol-2-one.
| Compound Name | 5-(1-chloro-2,2,3,3,3-pentafluoropropyl)-1-methyl-3H-indol-2-one |
|---|---|
| PubChem CID | 61085820 |
| Molecular Formula | C12H9ClF5NO |
| Molecular Weight | 313.65 g/mol |
| Exact Mass | 313.03 |
| IUPAC Name | 5-(1-chloro-2,2,3,3,3-pentafluoropropyl)-1-methyl-3H-indol-2-one |
| SMILES | CN1C(=O)Cc2cc(C(Cl)C(F)(F)C(F)(F)F)ccc21 |
| InChI | InChI=1S/C12H9ClF5NO/c1-19-8-3-2-6(4-7(8)5-9(19)20)10(13)11(14,15)12(16,17)18/h2-4,10H,5H2,1H3 |
| InChIKey | CBPRHMJUIVPWQO-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.65 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|