C10H8ClF5 — CID 61086137
1-(1-chloro-2,2,3,3,3-pentafluoropropyl)-4-methylbenzene (PubChem CID 61086137) has the molecular formula C10H8ClF5 and a molecular weight of 258.62 g/mol. Its IUPAC name is 1-(1-chloro-2,2,3,3,3-pentafluoropropyl)-4-methylbenzene.
| Compound Name | 1-(1-chloro-2,2,3,3,3-pentafluoropropyl)-4-methylbenzene |
|---|---|
| PubChem CID | 61086137 |
| Molecular Formula | C10H8ClF5 |
| Molecular Weight | 258.62 g/mol |
| Exact Mass | 258.02 |
| IUPAC Name | 1-(1-chloro-2,2,3,3,3-pentafluoropropyl)-4-methylbenzene |
| SMILES | Cc1ccc(C(Cl)C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C10H8ClF5/c1-6-2-4-7(5-3-6)8(11)9(12,13)10(14,15)16/h2-5,8H,1H3 |
| InChIKey | FTLQUADNWQKJNN-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.62 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|