About (7-bromo-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)-(furan-2-yl)methanol
(7-bromo-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)-(furan-2-yl)methanol (PubChem CID 61087648) has the molecular formula C14H13BrO4
and a molecular weight of 325.16 g/mol. Its IUPAC name is (7-bromo-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)-(furan-2-yl)methanol.
Molecular Properties
| Compound Name | (7-bromo-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)-(furan-2-yl)methanol |
| PubChem CID | 61087648 |
| Molecular Formula | C14H13BrO4 |
| Molecular Weight | 325.16 g/mol |
| Exact Mass | 324.00 |
| IUPAC Name | (7-bromo-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)-(furan-2-yl)methanol |
| SMILES | OC(c1ccco1)c1cc2c(cc1Br)OCCCO2 |
| InChI | InChI=1S/C14H13BrO4/c15-10-8-13-12(18-5-2-6-19-13)7-9(10)14(16)11-3-1-4-17-11/h1,3-4,7-8,14,16H,2,5-6H2 |
| InChIKey | AYOQCTQADZAAJR-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 51.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.16 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (7-bromo-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)-(furan-2-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7-bromo-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)-(furan-2-yl)methanol?
The IUPAC name of (7-bromo-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)-(furan-2-yl)methanol (CID 61087648) is (7-bromo-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)-(furan-2-yl)methanol.
What is the SMILES notation for (7-bromo-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)-(furan-2-yl)methanol?
The canonical SMILES for (7-bromo-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)-(furan-2-yl)methanol is OC(c1ccco1)c1cc2c(cc1Br)OCCCO2.
What is the InChIKey of (7-bromo-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)-(furan-2-yl)methanol?
The InChIKey is AYOQCTQADZAAJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13BrO4/c15-10-8-13-12(18-5-2-6-19-13)7-9(10)14(16)11-3-1-4-17-11/h1,3-4,7-8,14,16H,2,5-6H2.
What are the key properties of (7-bromo-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)-(furan-2-yl)methanol?
(7-bromo-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)-(furan-2-yl)methanol has a molecular weight of 325.16 g/mol, XLogP of 3.29, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (7-bromo-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)-(furan-2-yl)methanol is sourced from PubChem (CID 61087648), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).