C11H5F5OS — CID 61088441
(2,3,4,5,6-pentafluorophenyl)-thiophen-2-ylmethanol (PubChem CID 61088441) has the molecular formula C11H5F5OS and a molecular weight of 280.22 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl)-thiophen-2-ylmethanol.
| Compound Name | (2,3,4,5,6-pentafluorophenyl)-thiophen-2-ylmethanol |
|---|---|
| PubChem CID | 61088441 |
| Molecular Formula | C11H5F5OS |
| Molecular Weight | 280.22 g/mol |
| Exact Mass | 280.00 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl)-thiophen-2-ylmethanol |
| SMILES | OC(c1cccs1)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C11H5F5OS/c12-6-5(11(17)4-2-1-3-18-4)7(13)9(15)10(16)8(6)14/h1-3,11,17H |
| InChIKey | UXZYACNBFWXWBA-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.22 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|