C11H18OS — CID 61088727
1-(2,5-dimethylthiophen-3-yl)-3-methylbutan-1-ol (PubChem CID 61088727) has the molecular formula C11H18OS and a molecular weight of 198.33 g/mol. Its IUPAC name is 1-(2,5-dimethylthiophen-3-yl)-3-methylbutan-1-ol.
| Compound Name | 1-(2,5-dimethylthiophen-3-yl)-3-methylbutan-1-ol |
|---|---|
| PubChem CID | 61088727 |
| Molecular Formula | C11H18OS |
| Molecular Weight | 198.33 g/mol |
| Exact Mass | 198.11 |
| IUPAC Name | 1-(2,5-dimethylthiophen-3-yl)-3-methylbutan-1-ol |
| SMILES | Cc1cc(C(O)CC(C)C)c(C)s1 |
| InChI | InChI=1S/C11H18OS/c1-7(2)5-11(12)10-6-8(3)13-9(10)4/h6-7,11-12H,5H2,1-4H3 |
| InChIKey | IVOBEOFGZZZNNM-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.33 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |