C14H12N2OS — CID 61089322
(1-phenylpyrazol-4-yl)-thiophen-2-ylmethanol (PubChem CID 61089322) has the molecular formula C14H12N2OS and a molecular weight of 256.33 g/mol. Its IUPAC name is (1-phenylpyrazol-4-yl)-thiophen-2-ylmethanol.
| Compound Name | (1-phenylpyrazol-4-yl)-thiophen-2-ylmethanol |
|---|---|
| PubChem CID | 61089322 |
| Molecular Formula | C14H12N2OS |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | (1-phenylpyrazol-4-yl)-thiophen-2-ylmethanol |
| SMILES | OC(c1cnn(-c2ccccc2)c1)c1cccs1 |
| InChI | InChI=1S/C14H12N2OS/c17-14(13-7-4-8-18-13)11-9-15-16(10-11)12-5-2-1-3-6-12/h1-10,14,17H |
| InChIKey | QTNOQJJMEWYIJG-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |