About benzo[d][2]benzothiepine
benzo[d][2]benzothiepine (PubChem CID 610904) has the molecular formula C14H10S
and a molecular weight of 210.30 g/mol. Its IUPAC name is benzo[d][2]benzothiepine.
Molecular Properties
| Compound Name | benzo[d][2]benzothiepine |
| PubChem CID | 610904 |
| Molecular Formula | C14H10S |
| Molecular Weight | 210.30 g/mol |
| Exact Mass | 210.05 |
| IUPAC Name | benzo[d][2]benzothiepine |
| SMILES | C1=c2ccccc2=c2ccccc2=CS1 |
| InChI | InChI=1S/C14H10S/c1-3-7-13-11(5-1)9-15-10-12-6-2-4-8-14(12)13/h1-10H |
| InChIKey | NOMVDYFTPLNZSU-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.30 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze benzo[d][2]benzothiepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzo[d][2]benzothiepine?
The IUPAC name of benzo[d][2]benzothiepine (CID 610904) is benzo[d][2]benzothiepine.
What is the SMILES notation for benzo[d][2]benzothiepine?
The canonical SMILES for benzo[d][2]benzothiepine is C1=c2ccccc2=c2ccccc2=CS1.
What is the InChIKey of benzo[d][2]benzothiepine?
The InChIKey is NOMVDYFTPLNZSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10S/c1-3-7-13-11(5-1)9-15-10-12-6-2-4-8-14(12)13/h1-10H.
What are the key properties of benzo[d][2]benzothiepine?
benzo[d][2]benzothiepine has a molecular weight of 210.30 g/mol, XLogP of 2.20, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for benzo[d][2]benzothiepine is sourced from PubChem (CID 610904), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).