C10H14F3N5 — CID 61092160
5,6-dimethyl-3-[methyl(2,2,2-trifluoroethyl)amino]pyridazine-4-carboximidamide (PubChem CID 61092160) has the molecular formula C10H14F3N5 and a molecular weight of 261.25 g/mol. Its IUPAC name is 5,6-dimethyl-3-[methyl(2,2,2-trifluoroethyl)amino]pyridazine-4-carboximidamide.
| Compound Name | 5,6-dimethyl-3-[methyl(2,2,2-trifluoroethyl)amino]pyridazine-4-carboximidamide |
|---|---|
| PubChem CID | 61092160 |
| Molecular Formula | C10H14F3N5 |
| Molecular Weight | 261.25 g/mol |
| Exact Mass | 261.12 |
| IUPAC Name | 5,6-dimethyl-3-[methyl(2,2,2-trifluoroethyl)amino]pyridazine-4-carboximidamide |
| SMILES | [H]/N=C(\N)c1c(N(C)CC(F)(F)F)nnc(C)c1C |
| InChI | InChI=1S/C10H14F3N5/c1-5-6(2)16-17-9(7(5)8(14)15)18(3)4-10(11,12)13/h4H2,1-3H3,(H3,14,15) |
| InChIKey | KCGJSFAHKQWQQS-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 78.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.25 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|