C7H10N2OS — CID 61092296
3-amino-N,N-dimethylthiophene-2-carboxamide (PubChem CID 61092296) has the molecular formula C7H10N2OS and a molecular weight of 170.24 g/mol. Its IUPAC name is 3-amino-N,N-dimethylthiophene-2-carboxamide.
| Compound Name | 3-amino-N,N-dimethylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 61092296 |
| Molecular Formula | C7H10N2OS |
| Molecular Weight | 170.24 g/mol |
| Exact Mass | 170.05 |
| IUPAC Name | 3-amino-N,N-dimethylthiophene-2-carboxamide |
| SMILES | CN(C)C(=O)c1sccc1N |
| InChI | InChI=1S/C7H10N2OS/c1-9(2)7(10)6-5(8)3-4-11-6/h3-4H,8H2,1-2H3 |
| InChIKey | YXNPZILJGUEADR-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.24 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |