C12H15N5O — CID 61092674
2,4-diamino-N-(3,5-dimethyl-1H-pyrazol-4-yl)benzamide (PubChem CID 61092674) has the molecular formula C12H15N5O and a molecular weight of 245.29 g/mol. Its IUPAC name is 2,4-diamino-N-(3,5-dimethyl-1H-pyrazol-4-yl)benzamide.
| Compound Name | 2,4-diamino-N-(3,5-dimethyl-1H-pyrazol-4-yl)benzamide |
|---|---|
| PubChem CID | 61092674 |
| Molecular Formula | C12H15N5O |
| Molecular Weight | 245.29 g/mol |
| Exact Mass | 245.13 |
| IUPAC Name | 2,4-diamino-N-(3,5-dimethyl-1H-pyrazol-4-yl)benzamide |
| SMILES | Cc1n[nH]c(C)c1NC(=O)c1ccc(N)cc1N |
| InChI | InChI=1S/C12H15N5O/c1-6-11(7(2)17-16-6)15-12(18)9-4-3-8(13)5-10(9)14/h3-5H,13-14H2,1-2H3,(H,15,18)(H,16,17) |
| InChIKey | WNPAPEZIMGALNR-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 109.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.29 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|