C12H14F2N2OS — CID 61093800
5-amino-2,4-difluoro-N-methyl-N-(thiolan-3-yl)benzamide (PubChem CID 61093800) has the molecular formula C12H14F2N2OS and a molecular weight of 272.32 g/mol. Its IUPAC name is 5-amino-2,4-difluoro-N-methyl-N-(thiolan-3-yl)benzamide.
| Compound Name | 5-amino-2,4-difluoro-N-methyl-N-(thiolan-3-yl)benzamide |
|---|---|
| PubChem CID | 61093800 |
| Molecular Formula | C12H14F2N2OS |
| Molecular Weight | 272.32 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | 5-amino-2,4-difluoro-N-methyl-N-(thiolan-3-yl)benzamide |
| SMILES | CN(C(=O)c1cc(N)c(F)cc1F)C1CCSC1 |
| InChI | InChI=1S/C12H14F2N2OS/c1-16(7-2-3-18-6-7)12(17)8-4-11(15)10(14)5-9(8)13/h4-5,7H,2-3,6,15H2,1H3 |
| InChIKey | BLDHJJUWLKDPGF-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.32 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|