C16H25N3O — CID 61094001
3-amino-N-(cyclohexylmethyl)-4-(dimethylamino)benzamide (PubChem CID 61094001) has the molecular formula C16H25N3O and a molecular weight of 275.40 g/mol. Its IUPAC name is 3-amino-N-(cyclohexylmethyl)-4-(dimethylamino)benzamide.
| Compound Name | 3-amino-N-(cyclohexylmethyl)-4-(dimethylamino)benzamide |
|---|---|
| PubChem CID | 61094001 |
| Molecular Formula | C16H25N3O |
| Molecular Weight | 275.40 g/mol |
| Exact Mass | 275.20 |
| IUPAC Name | 3-amino-N-(cyclohexylmethyl)-4-(dimethylamino)benzamide |
| SMILES | CN(C)c1ccc(C(=O)NCC2CCCCC2)cc1N |
| InChI | InChI=1S/C16H25N3O/c1-19(2)15-9-8-13(10-14(15)17)16(20)18-11-12-6-4-3-5-7-12/h8-10,12H,3-7,11,17H2,1-2H3,(H,18,20) |
| InChIKey | PDHWWGQLJJYMKV-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.40 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|