About 4-amino-5-methyl-N-(2,2,2-trifluoroethyl)thiophene-2-carboxamide
4-amino-5-methyl-N-(2,2,2-trifluoroethyl)thiophene-2-carboxamide (PubChem CID 61094705) has the molecular formula C8H9F3N2OS
and a molecular weight of 238.23 g/mol. Its IUPAC name is 4-amino-5-methyl-N-(2,2,2-trifluoroethyl)thiophene-2-carboxamide.
Molecular Properties
| Compound Name | 4-amino-5-methyl-N-(2,2,2-trifluoroethyl)thiophene-2-carboxamide |
| PubChem CID | 61094705 |
| Molecular Formula | C8H9F3N2OS |
| Molecular Weight | 238.23 g/mol |
| Exact Mass | 238.04 |
| IUPAC Name | 4-amino-5-methyl-N-(2,2,2-trifluoroethyl)thiophene-2-carboxamide |
| SMILES | Cc1sc(C(=O)NCC(F)(F)F)cc1N |
| InChI | InChI=1S/C8H9F3N2OS/c1-4-5(12)2-6(15-4)7(14)13-3-8(9,10)11/h2H,3,12H2,1H3,(H,13,14) |
| InChIKey | VNHKQFHGQMMXNI-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.23 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-amino-5-methyl-N-(2,2,2-trifluoroethyl)thiophene-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-5-methyl-N-(2,2,2-trifluoroethyl)thiophene-2-carboxamide?
The IUPAC name of 4-amino-5-methyl-N-(2,2,2-trifluoroethyl)thiophene-2-carboxamide (CID 61094705) is 4-amino-5-methyl-N-(2,2,2-trifluoroethyl)thiophene-2-carboxamide.
What is the SMILES notation for 4-amino-5-methyl-N-(2,2,2-trifluoroethyl)thiophene-2-carboxamide?
The canonical SMILES for 4-amino-5-methyl-N-(2,2,2-trifluoroethyl)thiophene-2-carboxamide is Cc1sc(C(=O)NCC(F)(F)F)cc1N.
What is the InChIKey of 4-amino-5-methyl-N-(2,2,2-trifluoroethyl)thiophene-2-carboxamide?
The InChIKey is VNHKQFHGQMMXNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9F3N2OS/c1-4-5(12)2-6(15-4)7(14)13-3-8(9,10)11/h2H,3,12H2,1H3,(H,13,14).
What are the key properties of 4-amino-5-methyl-N-(2,2,2-trifluoroethyl)thiophene-2-carboxamide?
4-amino-5-methyl-N-(2,2,2-trifluoroethyl)thiophene-2-carboxamide has a molecular weight of 238.23 g/mol, XLogP of 1.93, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-5-methyl-N-(2,2,2-trifluoroethyl)thiophene-2-carboxamide is sourced from PubChem (CID 61094705), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).