C10H6BrClF3NO — CID 61095989
5-(1-bromo-2,2,2-trifluoroethyl)-6-chloro-1,3-dihydroindol-2-one (PubChem CID 61095989) has the molecular formula C10H6BrClF3NO and a molecular weight of 328.52 g/mol. Its IUPAC name is 5-(1-bromo-2,2,2-trifluoroethyl)-6-chloro-1,3-dihydroindol-2-one.
| Compound Name | 5-(1-bromo-2,2,2-trifluoroethyl)-6-chloro-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 61095989 |
| Molecular Formula | C10H6BrClF3NO |
| Molecular Weight | 328.52 g/mol |
| Exact Mass | 326.93 |
| IUPAC Name | 5-(1-bromo-2,2,2-trifluoroethyl)-6-chloro-1,3-dihydroindol-2-one |
| SMILES | O=C1Cc2cc(C(Br)C(F)(F)F)c(Cl)cc2N1 |
| InChI | InChI=1S/C10H6BrClF3NO/c11-9(10(13,14)15)5-1-4-2-8(17)16-7(4)3-6(5)12/h1,3,9H,2H2,(H,16,17) |
| InChIKey | CVQCPONNYYSRBM-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.52 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|