C11H6BrClF5NO — CID 61096392
5-(1-bromo-2,2,3,3,3-pentafluoropropyl)-6-chloro-1,3-dihydroindol-2-one (PubChem CID 61096392) has the molecular formula C11H6BrClF5NO and a molecular weight of 378.52 g/mol. Its IUPAC name is 5-(1-bromo-2,2,3,3,3-pentafluoropropyl)-6-chloro-1,3-dihydroindol-2-one.
| Compound Name | 5-(1-bromo-2,2,3,3,3-pentafluoropropyl)-6-chloro-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 61096392 |
| Molecular Formula | C11H6BrClF5NO |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 376.92 |
| IUPAC Name | 5-(1-bromo-2,2,3,3,3-pentafluoropropyl)-6-chloro-1,3-dihydroindol-2-one |
| SMILES | O=C1Cc2cc(C(Br)C(F)(F)C(F)(F)F)c(Cl)cc2N1 |
| InChI | InChI=1S/C11H6BrClF5NO/c12-9(10(14,15)11(16,17)18)5-1-4-2-8(20)19-7(4)3-6(5)13/h1,3,9H,2H2,(H,19,20) |
| InChIKey | YKTKKLOYTCVENF-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|