About 3-(3,4-difluorophenoxy)-5,6-dimethylpyridazine-4-carbothioamide
3-(3,4-difluorophenoxy)-5,6-dimethylpyridazine-4-carbothioamide (PubChem CID 61096470) has the molecular formula C13H11F2N3OS
and a molecular weight of 295.31 g/mol. Its IUPAC name is 3-(3,4-difluorophenoxy)-5,6-dimethylpyridazine-4-carbothioamide.
Molecular Properties
| Compound Name | 3-(3,4-difluorophenoxy)-5,6-dimethylpyridazine-4-carbothioamide |
| PubChem CID | 61096470 |
| Molecular Formula | C13H11F2N3OS |
| Molecular Weight | 295.31 g/mol |
| Exact Mass | 295.06 |
| IUPAC Name | 3-(3,4-difluorophenoxy)-5,6-dimethylpyridazine-4-carbothioamide |
| SMILES | Cc1nnc(Oc2ccc(F)c(F)c2)c(C(N)=S)c1C |
| InChI | InChI=1S/C13H11F2N3OS/c1-6-7(2)17-18-13(11(6)12(16)20)19-8-3-4-9(14)10(15)5-8/h3-5H,1-2H3,(H2,16,20) |
| InChIKey | PJDLMGZJXBOHSP-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.31 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-(3,4-difluorophenoxy)-5,6-dimethylpyridazine-4-carbothioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,4-difluorophenoxy)-5,6-dimethylpyridazine-4-carbothioamide?
The IUPAC name of 3-(3,4-difluorophenoxy)-5,6-dimethylpyridazine-4-carbothioamide (CID 61096470) is 3-(3,4-difluorophenoxy)-5,6-dimethylpyridazine-4-carbothioamide.
What is the SMILES notation for 3-(3,4-difluorophenoxy)-5,6-dimethylpyridazine-4-carbothioamide?
The canonical SMILES for 3-(3,4-difluorophenoxy)-5,6-dimethylpyridazine-4-carbothioamide is Cc1nnc(Oc2ccc(F)c(F)c2)c(C(N)=S)c1C.
What is the InChIKey of 3-(3,4-difluorophenoxy)-5,6-dimethylpyridazine-4-carbothioamide?
The InChIKey is PJDLMGZJXBOHSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11F2N3OS/c1-6-7(2)17-18-13(11(6)12(16)20)19-8-3-4-9(14)10(15)5-8/h3-5H,1-2H3,(H2,16,20).
What are the key properties of 3-(3,4-difluorophenoxy)-5,6-dimethylpyridazine-4-carbothioamide?
3-(3,4-difluorophenoxy)-5,6-dimethylpyridazine-4-carbothioamide has a molecular weight of 295.31 g/mol, XLogP of 2.80, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,4-difluorophenoxy)-5,6-dimethylpyridazine-4-carbothioamide is sourced from PubChem (CID 61096470), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).