C14H15BrO2S — CID 61096679
2-[bromo-(2,5-dimethoxyphenyl)methyl]-3-methylthiophene (PubChem CID 61096679) has the molecular formula C14H15BrO2S and a molecular weight of 327.24 g/mol. Its IUPAC name is 2-[bromo-(2,5-dimethoxyphenyl)methyl]-3-methylthiophene.
| Compound Name | 2-[bromo-(2,5-dimethoxyphenyl)methyl]-3-methylthiophene |
|---|---|
| PubChem CID | 61096679 |
| Molecular Formula | C14H15BrO2S |
| Molecular Weight | 327.24 g/mol |
| Exact Mass | 326.00 |
| IUPAC Name | 2-[bromo-(2,5-dimethoxyphenyl)methyl]-3-methylthiophene |
| SMILES | COc1ccc(OC)c(C(Br)c2sccc2C)c1 |
| InChI | InChI=1S/C14H15BrO2S/c1-9-6-7-18-14(9)13(15)11-8-10(16-2)4-5-12(11)17-3/h4-8,13H,1-3H3 |
| InChIKey | METOFJJWLPIENB-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.24 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|