About 5-[1-bromo-2-(2-chloro-6-fluorophenyl)ethyl]-1,3-dihydroindol-2-one
5-[1-bromo-2-(2-chloro-6-fluorophenyl)ethyl]-1,3-dihydroindol-2-one (PubChem CID 61097336) has the molecular formula C16H12BrClFNO
and a molecular weight of 368.63 g/mol. Its IUPAC name is 5-[1-bromo-2-(2-chloro-6-fluorophenyl)ethyl]-1,3-dihydroindol-2-one.
Molecular Properties
| Compound Name | 5-[1-bromo-2-(2-chloro-6-fluorophenyl)ethyl]-1,3-dihydroindol-2-one |
| PubChem CID | 61097336 |
| Molecular Formula | C16H12BrClFNO |
| Molecular Weight | 368.63 g/mol |
| Exact Mass | 366.98 |
| IUPAC Name | 5-[1-bromo-2-(2-chloro-6-fluorophenyl)ethyl]-1,3-dihydroindol-2-one |
| SMILES | O=C1Cc2cc(C(Br)Cc3c(F)cccc3Cl)ccc2N1 |
| InChI | InChI=1S/C16H12BrClFNO/c17-12(8-11-13(18)2-1-3-14(11)19)9-4-5-15-10(6-9)7-16(21)20-15/h1-6,12H,7-8H2,(H,20,21) |
| InChIKey | ZWLPKLGWQSVEIU-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.63 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5-[1-bromo-2-(2-chloro-6-fluorophenyl)ethyl]-1,3-dihydroindol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[1-bromo-2-(2-chloro-6-fluorophenyl)ethyl]-1,3-dihydroindol-2-one?
The IUPAC name of 5-[1-bromo-2-(2-chloro-6-fluorophenyl)ethyl]-1,3-dihydroindol-2-one (CID 61097336) is 5-[1-bromo-2-(2-chloro-6-fluorophenyl)ethyl]-1,3-dihydroindol-2-one.
What is the SMILES notation for 5-[1-bromo-2-(2-chloro-6-fluorophenyl)ethyl]-1,3-dihydroindol-2-one?
The canonical SMILES for 5-[1-bromo-2-(2-chloro-6-fluorophenyl)ethyl]-1,3-dihydroindol-2-one is O=C1Cc2cc(C(Br)Cc3c(F)cccc3Cl)ccc2N1.
What is the InChIKey of 5-[1-bromo-2-(2-chloro-6-fluorophenyl)ethyl]-1,3-dihydroindol-2-one?
The InChIKey is ZWLPKLGWQSVEIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12BrClFNO/c17-12(8-11-13(18)2-1-3-14(11)19)9-4-5-15-10(6-9)7-16(21)20-15/h1-6,12H,7-8H2,(H,20,21).
What are the key properties of 5-[1-bromo-2-(2-chloro-6-fluorophenyl)ethyl]-1,3-dihydroindol-2-one?
5-[1-bromo-2-(2-chloro-6-fluorophenyl)ethyl]-1,3-dihydroindol-2-one has a molecular weight of 368.63 g/mol, XLogP of 4.65, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[1-bromo-2-(2-chloro-6-fluorophenyl)ethyl]-1,3-dihydroindol-2-one is sourced from PubChem (CID 61097336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).