C16H21BrN2 — CID 61097781
2-(2-bromo-4-methyl-3-phenylhexyl)-1H-imidazole (PubChem CID 61097781) has the molecular formula C16H21BrN2 and a molecular weight of 321.26 g/mol. Its IUPAC name is 2-(2-bromo-4-methyl-3-phenylhexyl)-1H-imidazole.
| Compound Name | 2-(2-bromo-4-methyl-3-phenylhexyl)-1H-imidazole |
|---|---|
| PubChem CID | 61097781 |
| Molecular Formula | C16H21BrN2 |
| Molecular Weight | 321.26 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | 2-(2-bromo-4-methyl-3-phenylhexyl)-1H-imidazole |
| SMILES | CCC(C)C(c1ccccc1)C(Br)Cc1ncc[nH]1 |
| InChI | InChI=1S/C16H21BrN2/c1-3-12(2)16(13-7-5-4-6-8-13)14(17)11-15-18-9-10-19-15/h4-10,12,14,16H,3,11H2,1-2H3,(H,18,19) |
| InChIKey | AVTQODRZRNCUHN-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.26 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|