About 2-amino-5-bromo-1H-pyrrole-3,4-dicarbonitrile
2-amino-5-bromo-1H-pyrrole-3,4-dicarbonitrile (PubChem CID 610978) has the molecular formula C6H3BrN4
and a molecular weight of 211.02 g/mol. Its IUPAC name is 2-amino-5-bromo-1H-pyrrole-3,4-dicarbonitrile.
Molecular Properties
| Compound Name | 2-amino-5-bromo-1H-pyrrole-3,4-dicarbonitrile |
| PubChem CID | 610978 |
| Molecular Formula | C6H3BrN4 |
| Molecular Weight | 211.02 g/mol |
| Exact Mass | 209.95 |
| IUPAC Name | 2-amino-5-bromo-1H-pyrrole-3,4-dicarbonitrile |
| SMILES | N#Cc1c(N)[nH]c(Br)c1C#N |
| InChI | InChI=1S/C6H3BrN4/c7-5-3(1-8)4(2-9)6(10)11-5/h11H,10H2 |
| InChIKey | YOKMIDCZQYUXOI-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 89.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.02 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-amino-5-bromo-1H-pyrrole-3,4-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-5-bromo-1H-pyrrole-3,4-dicarbonitrile?
The IUPAC name of 2-amino-5-bromo-1H-pyrrole-3,4-dicarbonitrile (CID 610978) is 2-amino-5-bromo-1H-pyrrole-3,4-dicarbonitrile.
What is the SMILES notation for 2-amino-5-bromo-1H-pyrrole-3,4-dicarbonitrile?
The canonical SMILES for 2-amino-5-bromo-1H-pyrrole-3,4-dicarbonitrile is N#Cc1c(N)[nH]c(Br)c1C#N.
What is the InChIKey of 2-amino-5-bromo-1H-pyrrole-3,4-dicarbonitrile?
The InChIKey is YOKMIDCZQYUXOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3BrN4/c7-5-3(1-8)4(2-9)6(10)11-5/h11H,10H2.
What are the key properties of 2-amino-5-bromo-1H-pyrrole-3,4-dicarbonitrile?
2-amino-5-bromo-1H-pyrrole-3,4-dicarbonitrile has a molecular weight of 211.02 g/mol, XLogP of 1.10, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-5-bromo-1H-pyrrole-3,4-dicarbonitrile is sourced from PubChem (CID 610978), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).