About 3-(1-bromoethyl)-2,5-dichlorothiophene
3-(1-bromoethyl)-2,5-dichlorothiophene (PubChem CID 61097973) has the molecular formula C6H5BrCl2S
and a molecular weight of 259.98 g/mol. Its IUPAC name is 3-(1-bromoethyl)-2,5-dichlorothiophene.
Molecular Properties
| Compound Name | 3-(1-bromoethyl)-2,5-dichlorothiophene |
| PubChem CID | 61097973 |
| Molecular Formula | C6H5BrCl2S |
| Molecular Weight | 259.98 g/mol |
| Exact Mass | 257.87 |
| IUPAC Name | 3-(1-bromoethyl)-2,5-dichlorothiophene |
| SMILES | CC(Br)c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C6H5BrCl2S/c1-3(7)4-2-5(8)10-6(4)9/h2-3H,1H3 |
| InChIKey | BTOCIQZHRCPGGV-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.98 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-(1-bromoethyl)-2,5-dichlorothiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1-bromoethyl)-2,5-dichlorothiophene?
The IUPAC name of 3-(1-bromoethyl)-2,5-dichlorothiophene (CID 61097973) is 3-(1-bromoethyl)-2,5-dichlorothiophene.
What is the SMILES notation for 3-(1-bromoethyl)-2,5-dichlorothiophene?
The canonical SMILES for 3-(1-bromoethyl)-2,5-dichlorothiophene is CC(Br)c1cc(Cl)sc1Cl.
What is the InChIKey of 3-(1-bromoethyl)-2,5-dichlorothiophene?
The InChIKey is BTOCIQZHRCPGGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5BrCl2S/c1-3(7)4-2-5(8)10-6(4)9/h2-3H,1H3.
What are the key properties of 3-(1-bromoethyl)-2,5-dichlorothiophene?
3-(1-bromoethyl)-2,5-dichlorothiophene has a molecular weight of 259.98 g/mol, XLogP of 4.51, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1-bromoethyl)-2,5-dichlorothiophene is sourced from PubChem (CID 61097973), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).