C14H19BrO2 — CID 61098077
7-(1-bromo-2-methylbutyl)-3,4-dihydro-2H-1,5-benzodioxepine (PubChem CID 61098077) has the molecular formula C14H19BrO2 and a molecular weight of 299.21 g/mol. Its IUPAC name is 7-(1-bromo-2-methylbutyl)-3,4-dihydro-2H-1,5-benzodioxepine.
| Compound Name | 7-(1-bromo-2-methylbutyl)-3,4-dihydro-2H-1,5-benzodioxepine |
|---|---|
| PubChem CID | 61098077 |
| Molecular Formula | C14H19BrO2 |
| Molecular Weight | 299.21 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | 7-(1-bromo-2-methylbutyl)-3,4-dihydro-2H-1,5-benzodioxepine |
| SMILES | CCC(C)C(Br)c1ccc2c(c1)OCCCO2 |
| InChI | InChI=1S/C14H19BrO2/c1-3-10(2)14(15)11-5-6-12-13(9-11)17-8-4-7-16-12/h5-6,9-10,14H,3-4,7-8H2,1-2H3 |
| InChIKey | PNAHXLWBNNUQGH-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.21 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|