C10H13F3N4S — CID 61098464
5,6-dimethyl-3-[methyl(2,2,2-trifluoroethyl)amino]pyridazine-4-carbothioamide (PubChem CID 61098464) has the molecular formula C10H13F3N4S and a molecular weight of 278.30 g/mol. Its IUPAC name is 5,6-dimethyl-3-[methyl(2,2,2-trifluoroethyl)amino]pyridazine-4-carbothioamide.
| Compound Name | 5,6-dimethyl-3-[methyl(2,2,2-trifluoroethyl)amino]pyridazine-4-carbothioamide |
|---|---|
| PubChem CID | 61098464 |
| Molecular Formula | C10H13F3N4S |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | 5,6-dimethyl-3-[methyl(2,2,2-trifluoroethyl)amino]pyridazine-4-carbothioamide |
| SMILES | Cc1nnc(N(C)CC(F)(F)F)c(C(N)=S)c1C |
| InChI | InChI=1S/C10H13F3N4S/c1-5-6(2)15-16-9(7(5)8(14)18)17(3)4-10(11,12)13/h4H2,1-3H3,(H2,14,18) |
| InChIKey | MLXMOYBFGMZZAE-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.30 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|