About 3-(2-fluorophenoxy)-5,6-dimethylpyridazine-4-carbothioamide
3-(2-fluorophenoxy)-5,6-dimethylpyridazine-4-carbothioamide (PubChem CID 61098480) has the molecular formula C13H12FN3OS
and a molecular weight of 277.32 g/mol. Its IUPAC name is 3-(2-fluorophenoxy)-5,6-dimethylpyridazine-4-carbothioamide.
Molecular Properties
| Compound Name | 3-(2-fluorophenoxy)-5,6-dimethylpyridazine-4-carbothioamide |
| PubChem CID | 61098480 |
| Molecular Formula | C13H12FN3OS |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | 3-(2-fluorophenoxy)-5,6-dimethylpyridazine-4-carbothioamide |
| SMILES | Cc1nnc(Oc2ccccc2F)c(C(N)=S)c1C |
| InChI | InChI=1S/C13H12FN3OS/c1-7-8(2)16-17-13(11(7)12(15)19)18-10-6-4-3-5-9(10)14/h3-6H,1-2H3,(H2,15,19) |
| InChIKey | ZXYMIXFGXLBRLI-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-fluorophenoxy)-5,6-dimethylpyridazine-4-carbothioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-fluorophenoxy)-5,6-dimethylpyridazine-4-carbothioamide?
The IUPAC name of 3-(2-fluorophenoxy)-5,6-dimethylpyridazine-4-carbothioamide (CID 61098480) is 3-(2-fluorophenoxy)-5,6-dimethylpyridazine-4-carbothioamide.
What is the SMILES notation for 3-(2-fluorophenoxy)-5,6-dimethylpyridazine-4-carbothioamide?
The canonical SMILES for 3-(2-fluorophenoxy)-5,6-dimethylpyridazine-4-carbothioamide is Cc1nnc(Oc2ccccc2F)c(C(N)=S)c1C.
What is the InChIKey of 3-(2-fluorophenoxy)-5,6-dimethylpyridazine-4-carbothioamide?
The InChIKey is ZXYMIXFGXLBRLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12FN3OS/c1-7-8(2)16-17-13(11(7)12(15)19)18-10-6-4-3-5-9(10)14/h3-6H,1-2H3,(H2,15,19).
What are the key properties of 3-(2-fluorophenoxy)-5,6-dimethylpyridazine-4-carbothioamide?
3-(2-fluorophenoxy)-5,6-dimethylpyridazine-4-carbothioamide has a molecular weight of 277.32 g/mol, XLogP of 2.66, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-fluorophenoxy)-5,6-dimethylpyridazine-4-carbothioamide is sourced from PubChem (CID 61098480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).