C9H10F3N3OS — CID 61098848
5,6-dimethyl-3-(2,2,2-trifluoroethoxy)pyridazine-4-carbothioamide (PubChem CID 61098848) has the molecular formula C9H10F3N3OS and a molecular weight of 265.26 g/mol. Its IUPAC name is 5,6-dimethyl-3-(2,2,2-trifluoroethoxy)pyridazine-4-carbothioamide.
| Compound Name | 5,6-dimethyl-3-(2,2,2-trifluoroethoxy)pyridazine-4-carbothioamide |
|---|---|
| PubChem CID | 61098848 |
| Molecular Formula | C9H10F3N3OS |
| Molecular Weight | 265.26 g/mol |
| Exact Mass | 265.05 |
| IUPAC Name | 5,6-dimethyl-3-(2,2,2-trifluoroethoxy)pyridazine-4-carbothioamide |
| SMILES | Cc1nnc(OCC(F)(F)F)c(C(N)=S)c1C |
| InChI | InChI=1S/C9H10F3N3OS/c1-4-5(2)14-15-8(6(4)7(13)17)16-3-9(10,11)12/h3H2,1-2H3,(H2,13,17) |
| InChIKey | UIPHZVGXAXFJPD-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.26 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|