C17H18O4 — CID 61099921
2,3-dihydro-1-benzofuran-5-yl-(2,4-dimethoxyphenyl)methanol (PubChem CID 61099921) has the molecular formula C17H18O4 and a molecular weight of 286.33 g/mol. Its IUPAC name is 2,3-dihydro-1-benzofuran-5-yl-(2,4-dimethoxyphenyl)methanol.
| Compound Name | 2,3-dihydro-1-benzofuran-5-yl-(2,4-dimethoxyphenyl)methanol |
|---|---|
| PubChem CID | 61099921 |
| Molecular Formula | C17H18O4 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | 2,3-dihydro-1-benzofuran-5-yl-(2,4-dimethoxyphenyl)methanol |
| SMILES | COc1ccc(C(O)c2ccc3c(c2)CCO3)c(OC)c1 |
| InChI | InChI=1S/C17H18O4/c1-19-13-4-5-14(16(10-13)20-2)17(18)12-3-6-15-11(9-12)7-8-21-15/h3-6,9-10,17-18H,7-8H2,1-2H3 |
| InChIKey | VGYVLCBLSHKOAO-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |