C9H9BrF5NS — CID 61102636
1-(5-bromothiophen-2-yl)-N-ethyl-2,2,3,3,3-pentafluoropropan-1-amine (PubChem CID 61102636) has the molecular formula C9H9BrF5NS and a molecular weight of 338.14 g/mol. Its IUPAC name is 1-(5-bromothiophen-2-yl)-N-ethyl-2,2,3,3,3-pentafluoropropan-1-amine.
| Compound Name | 1-(5-bromothiophen-2-yl)-N-ethyl-2,2,3,3,3-pentafluoropropan-1-amine |
|---|---|
| PubChem CID | 61102636 |
| Molecular Formula | C9H9BrF5NS |
| Molecular Weight | 338.14 g/mol |
| Exact Mass | 336.96 |
| IUPAC Name | 1-(5-bromothiophen-2-yl)-N-ethyl-2,2,3,3,3-pentafluoropropan-1-amine |
| SMILES | CCNC(c1ccc(Br)s1)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H9BrF5NS/c1-2-16-7(5-3-4-6(10)17-5)8(11,12)9(13,14)15/h3-4,7,16H,2H2,1H3 |
| InChIKey | HSCJOWUSOCXDGN-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.14 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|